1,3,4-Thiadiazol-2-aMine, 5-(2-fluorophenyl)- - Names and Identifiers
Name | 5-(2-fluorophenyl)-1,3,4-thiadiazol-2-amine
|
Synonyms | 5-(2-Fluorophenyl)-1,3,4-thiadiazol-2-amine 5-(2-fluorophenyl)-1,3,4-thiadiazol-2-amine 1,3,4-Thiadiazol-2-amine, 5-(2-fluorophenyl)- 1,3,4-Thiadiazol-2-aMine, 5-(2-fluorophenyl)-
|
CAS | 59565-51-4
|
InChI | InChI=1/C8H6FN3S/c9-6-4-2-1-3-5(6)7-11-12-8(10)13-7/h1-4H,(H2,10,12) |
1,3,4-Thiadiazol-2-aMine, 5-(2-fluorophenyl)- - Physico-chemical Properties
Molecular Formula | C8H6FN3S
|
Molar Mass | 195.22 |
Density | 1.423g/cm3 |
Boling Point | 360.5°C at 760 mmHg |
Flash Point | 171.8°C |
Vapor Presure | 2.21E-05mmHg at 25°C |
Storage Condition | 2-8℃ |
Refractive Index | 1.643 |
1,3,4-Thiadiazol-2-aMine, 5-(2-fluorophenyl)- - Introduction
5-(2-fluorophenyl)-1,3,4-thiadiazol-2-amine is an organic compound with the chemical formula C8H6FN3S.
Nature:
-Appearance as a white crystalline solid.
-It has a high melting point and relatively low solubility.
-In chemical reactions, it can be used as an amination reagent for substitution reactions.
Use:
- 5-(2-fluorophenyl)-1,3,4-thiadiazol-2-amine can be used as a pesticide intermediate. It can be involved in the synthesis of many insecticides and fungicides.
-It can also be used as a drug intermediate to participate in the synthesis of biologically active compounds.
Preparation Method:
5-(2-fluorophenyl)-1,3,4-thiadiazol-2-amine can be synthesized by the following steps:
1. p-nitrophenylthizone is reacted with hydrofluoric acid to obtain p-fluorophenylthizone.
2. p-fluorophenylthizone reacts with ammonia to generate 5-aminophenyl -2-amino -1,3,4-thiadiazole.
3. Finally, hydrogen fluoride was introduced into the reaction system of 5-aminophenyl-2-amino-1, 3,4-thiadiazole to obtain 5-(2-fluorophenyl)-1,3,4-thiadiazol-2-amine.
Safety Information:
There is a lack of complete information on the safety of 5-(2-fluorophenyl)-1,3,4-thiadiazol-2-amine. However, as an organic compound, it should generally be handled with appropriate safety measures. For example, wear personal protective equipment such as glasses, gloves, and lab clothes. Avoid contact with skin, inhalation of gases and swallowing during operation. If necessary, refer to a reliable chemical safety manual or consult a professional for more detailed safety information.
Last Update:2024-04-09 21:54:55